CAS 1152510-00-3 appears in our catalog under these names: 1-(1-(2,5-Dimethylphenyl)-5-methyl-1H-pyrazol-4-yl)ethan-1-one, 95%, 1-(1-(2,5-Dimethylphenyl)-5-methyl-1H-pyrazol-4-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-[1-(2,5-dimethylphenyl)-5-methylpyrazol-4-yl]ethanone (CAS 1152510-00-3) is a chemical compound with the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. IUPAC name: 1-[1-(2,5-dimethylphenyl)-5-methylpyrazol-4-yl]ethanone. InChIKey: SWXPVGQCJNLZKO-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | 1-[1-(2,5-dimethylphenyl)-5-methylpyrazol-4-yl]ethanone |
| InChIKey | SWXPVGQCJNLZKO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)N2C(=C(C=N2)C(=O)C)C |
Computed by PubChem (NCBI)