CAS 1152546-35-4 is the registry number for 3-(2,5-Difluorophenyl)-1-methyl-1H-pyrazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(2,5-difluorophenyl)-1-methylpyrazole-4-carbaldehyde (CAS 1152546-35-4) is a chemical compound with the molecular formula C11H8F2N2O and a molecular weight of 222.19 g/mol. IUPAC name: 3-(2,5-difluorophenyl)-1-methylpyrazole-4-carbaldehyde. InChIKey: YSXXOFSIVDSAQM-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)-1-methylpyrazole-4-carbaldehyde |
| InChIKey | YSXXOFSIVDSAQM-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=C(C=CC(=C2)F)F)C=O |
Computed by PubChem (NCBI)