CAS 1341457-19-9 appears in our catalog under these names: 6-(2,3-Difluorophenoxy)pyridin-3-amine, 98%, 6-(2,3-Difluorophenoxy)pyridin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
6-(2,3-difluorophenoxy)pyridin-3-amine (CAS 1341457-19-9) is a chemical compound with the molecular formula C11H8F2N2O and a molecular weight of 222.19 g/mol. IUPAC name: 6-(2,3-difluorophenoxy)pyridin-3-amine. InChIKey: FTAJMFXJHMYGOB-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 6-(2,3-difluorophenoxy)pyridin-3-amine |
| InChIKey | FTAJMFXJHMYGOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)OC2=NC=C(C=C2)N |
Computed by PubChem (NCBI)