Products 1152548-17-8
CAS 1152548-17-8 is the registry number for 1,3-Di-tert-butyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1,3-ditert-butylpyrazole-4-carboxylic acid (CAS 1152548-17-8) is a chemical compound with the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. IUPAC name: 1,3-ditert-butylpyrazole-4-carboxylic acid. InChIKey: MHSIHRZPQNUXAH-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 1,3-ditert-butylpyrazole-4-carboxylic acid |
| InChIKey | MHSIHRZPQNUXAH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C=C1C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)