CAS 1152566-19-2 appears in our catalog under these names: 1-(2-Chloropropanoyl)-3-(2,2,2-trifluoroethyl)urea, 1-(2-Chloropropanoyl)-3-(2,2,2-trifluoroethyl)urea, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
2-chloro-N-(2,2,2-trifluoroethylcarbamoyl)propanamide (CAS 1152566-19-2) is a chemical compound with the molecular formula C6H8ClF3N2O2 and a molecular weight of 232.59 g/mol. IUPAC name: 2-chloro-N-(2,2,2-trifluoroethylcarbamoyl)propanamide. InChIKey: MWWZRXPYACBMPS-UHFFFAOYSA-N.
| Molecular formula | C6H8ClF3N2O2 |
|---|---|
| Molecular weight | 232.59 g/mol |
| IUPAC name | 2-chloro-N-(2,2,2-trifluoroethylcarbamoyl)propanamide |
| InChIKey | MWWZRXPYACBMPS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC(=O)NCC(F)(F)F)Cl |
Computed by PubChem (NCBI)