CAS 1422344-02-2 is the registry number for 1-(2,2,2-Trifluoroethyl)piperazine-2,6-dione hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2,2,2-trifluoroethyl)piperazine-2,6-dione;hydrochloride (CAS 1422344-02-2) is a chemical compound with the molecular formula C6H8ClF3N2O2 and a molecular weight of 232.59 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)piperazine-2,6-dione;hydrochloride. InChIKey: BHKUWULSJLWIQM-UHFFFAOYSA-N.
| Molecular formula | C6H8ClF3N2O2 |
|---|---|
| Molecular weight | 232.59 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)piperazine-2,6-dione;hydrochloride |
| InChIKey | BHKUWULSJLWIQM-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)CN1)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)