Products 1152583-42-0
CAS 1152583-42-0 is the registry number for 5-Chloro-1-(4-chlorophenyl)-3-isopropyl-1H-pyrazole-4-carbaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-1-(4-chlorophenyl)-3-propan-2-ylpyrazole-4-carbaldehyde (CAS 1152583-42-0) is a chemical compound with the molecular formula C13H12Cl2N2O and a molecular weight of 283.15 g/mol. IUPAC name: 5-chloro-1-(4-chlorophenyl)-3-propan-2-ylpyrazole-4-carbaldehyde. InChIKey: IWTWEKYGRBZVBD-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O |
|---|---|
| Molecular weight | 283.15 g/mol |
| IUPAC name | 5-chloro-1-(4-chlorophenyl)-3-propan-2-ylpyrazole-4-carbaldehyde |
| InChIKey | IWTWEKYGRBZVBD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C(=C1C=O)Cl)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)