Products 912763-66-7
CAS 912763-66-7 is the registry number for 2,6-Dichloro-N-(1-cyanocyclopentyl)benzamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dichloro-N-(1-cyanocyclopentyl)benzamide (CAS 912763-66-7) is a chemical compound with the molecular formula C13H12Cl2N2O and a molecular weight of 283.15 g/mol. IUPAC name: 2,6-dichloro-N-(1-cyanocyclopentyl)benzamide. InChIKey: JPTINSGANUDGGF-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O |
|---|---|
| Molecular weight | 283.15 g/mol |
| IUPAC name | 2,6-dichloro-N-(1-cyanocyclopentyl)benzamide |
| InChIKey | JPTINSGANUDGGF-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C#N)NC(=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)