CAS 1152588-03-8 appears in our catalog under these names: 5-(3-(Dimethylamino)phenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(3-(Dimethylamino)phenyl)-1,3,4-oxadiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-[3-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-amine (CAS 1152588-03-8) is a chemical compound with the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. IUPAC name: 5-[3-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-amine. InChIKey: CPYUORMIAPGDQY-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 5-[3-(dimethylamino)phenyl]-1,3,4-oxadiazol-2-amine |
| InChIKey | CPYUORMIAPGDQY-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC(=C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)