CAS 1152609-74-9 is the registry number for 3,4-Difluoro-N-((trimethyl-1H-pyrazol-4-yl)methyl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,4-difluoro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]aniline (CAS 1152609-74-9) is a chemical compound with the molecular formula C13H15F2N3 and a molecular weight of 251.27 g/mol. IUPAC name: 3,4-difluoro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]aniline. InChIKey: AQHADZUOKDUTKM-UHFFFAOYSA-N.
| Molecular formula | C13H15F2N3 |
|---|---|
| Molecular weight | 251.27 g/mol |
| IUPAC name | 3,4-difluoro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]aniline |
| InChIKey | AQHADZUOKDUTKM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)CNC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)