CAS 778611-49-7 is the registry number for 3-tert-butyl-1-(2,4-difluorophenyl)-1H-pyrazol-5-amine, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 10g.
3-tert-butyl-1-(2,4-difluorophenyl)pyrazol-5-amine (CAS 778611-49-7) is a chemical compound with the molecular formula C13H15F2N3 and a molecular weight of 251.27 g/mol. IUPAC name: 3-tert-butyl-1-(2,4-difluorophenyl)pyrazol-5-amine. InChIKey: WDQWTQHRMAIEPI-UHFFFAOYSA-N.
| Molecular formula | C13H15F2N3 |
|---|---|
| Molecular weight | 251.27 g/mol |
| IUPAC name | 3-tert-butyl-1-(2,4-difluorophenyl)pyrazol-5-amine |
| InChIKey | WDQWTQHRMAIEPI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)