CAS 1152837-03-0 is the registry number for 1-(2,3-Dihydro-1H-inden-5-yl)-2,2-dimethylpropan-1-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropan-1-one (CAS 1152837-03-0) is a chemical compound with the molecular formula C14H18O and a molecular weight of 202.29 g/mol. IUPAC name: 1-(2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropan-1-one. InChIKey: MUYOJOIWSYEDFJ-UHFFFAOYSA-N.
| Molecular formula | C14H18O |
|---|---|
| Molecular weight | 202.29 g/mol |
| IUPAC name | 1-(2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropan-1-one |
| InChIKey | MUYOJOIWSYEDFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC2=C(CCC2)C=C1 |
Computed by PubChem (NCBI)