Products 1152866-40-4
CAS 1152866-40-4 is the registry number for 1-(Trimethyl-1H-pyrazole-4-amido)cyclopentane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]cyclopentane-1-carboxylic acid (CAS 1152866-40-4) is a chemical compound with the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. IUPAC name: 1-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]cyclopentane-1-carboxylic acid. InChIKey: XSOJFKTWIAOWCV-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O3 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 1-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]cyclopentane-1-carboxylic acid |
| InChIKey | XSOJFKTWIAOWCV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)C(=O)NC2(CCCC2)C(=O)O |
Computed by PubChem (NCBI)