CAS 1152867-99-6 is the registry number for 1-(4-(3,5-Dimethyl-1H-pyrazol-1-yl)-3-fluorophenyl)ethanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanone (CAS 1152867-99-6) is a chemical compound with the molecular formula C13H13FN2O and a molecular weight of 232.25 g/mol. IUPAC name: 1-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanone. InChIKey: QBBWLGIFBSASET-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2O |
|---|---|
| Molecular weight | 232.25 g/mol |
| IUPAC name | 1-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanone |
| InChIKey | QBBWLGIFBSASET-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=C(C=C(C=C2)C(=O)C)F)C |
Computed by PubChem (NCBI)