CAS 1355175-23-3 is the registry number for 9-Fluoro-6-methyl-1,3,4,5-tetrahydrobenzo[b]-1,6-naphthyridin-10(2h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
9-fluoro-6-methyl-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridin-10-one (CAS 1355175-23-3) is a chemical compound with the molecular formula C13H13FN2O and a molecular weight of 232.25 g/mol. IUPAC name: 9-fluoro-6-methyl-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridin-10-one. InChIKey: FFUGKJSKUZKWGQ-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2O |
|---|---|
| Molecular weight | 232.25 g/mol |
| IUPAC name | 9-fluoro-6-methyl-2,3,4,5-tetrahydro-1H-benzo[b][1,6]naphthyridin-10-one |
| InChIKey | FFUGKJSKUZKWGQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)F)C(=O)C3=C(N2)CCNC3 |
Computed by PubChem (NCBI)