Products 1152881-60-1
CAS 1152881-60-1 is the registry number for 4-((1,1-Dimethyl-1H-1l4-pyrazole)-4-sulfonamido)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[methyl-(1-methylpyrazol-4-yl)sulfonylamino]butanoic acid (CAS 1152881-60-1) is a chemical compound with the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. IUPAC name: 4-[methyl-(1-methylpyrazol-4-yl)sulfonylamino]butanoic acid. InChIKey: JXXDZZNUYOVFHE-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O4S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | 4-[methyl-(1-methylpyrazol-4-yl)sulfonylamino]butanoic acid |
| InChIKey | JXXDZZNUYOVFHE-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)S(=O)(=O)N(C)CCCC(=O)O |
Computed by PubChem (NCBI)