CAS 1375958-20-5 is the registry number for 2-(N-Methylethylsulfonamido)-N-(5-methylisoxazol-3-yl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[ethylsulfonyl(methyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (CAS 1375958-20-5) is a chemical compound with the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. IUPAC name: 2-[ethylsulfonyl(methyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide. InChIKey: WSFNQJBZWICYIU-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O4S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | 2-[ethylsulfonyl(methyl)amino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| InChIKey | WSFNQJBZWICYIU-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N(C)CC(=O)NC1=NOC(=C1)C |
Computed by PubChem (NCBI)