CAS 1152953-02-0 is the registry number for 2-((1,3,4-Thiadiazol-2-yl)thio)-1-(2,5-dimethyl-1H-pyrrol-3-yl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,5-dimethyl-1H-pyrrol-3-yl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)ethanone (CAS 1152953-02-0) is a chemical compound with the molecular formula C10H11N3OS2 and a molecular weight of 253.3 g/mol. IUPAC name: 1-(2,5-dimethyl-1H-pyrrol-3-yl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)ethanone. InChIKey: VHOGKNRUMZVBIB-UHFFFAOYSA-N.
| Molecular formula | C10H11N3OS2 |
|---|---|
| Molecular weight | 253.3 g/mol |
| IUPAC name | 1-(2,5-dimethyl-1H-pyrrol-3-yl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)ethanone |
| InChIKey | VHOGKNRUMZVBIB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1)C)C(=O)CSC2=NN=CS2 |
Computed by PubChem (NCBI)