CAS 379728-86-6 appears in our catalog under these names: 5-(2-Methoxy-5-methyl-phenylamino)-[1,3,4]thiadiazole-2-thiol, 95%, 5-((2-Methoxy-5-methylphenyl)amino)-1,3,4-thiadiazole-2-thiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.
5-(2-methoxy-5-methylanilino)-3H-1,3,4-thiadiazole-2-thione (CAS 379728-86-6) is a chemical compound with the molecular formula C10H11N3OS2 and a molecular weight of 253.3 g/mol. IUPAC name: 5-(2-methoxy-5-methylanilino)-3H-1,3,4-thiadiazole-2-thione. InChIKey: CAKSBWQTZZGWDD-UHFFFAOYSA-N.
| Molecular formula | C10H11N3OS2 |
|---|---|
| Molecular weight | 253.3 g/mol |
| IUPAC name | 5-(2-methoxy-5-methylanilino)-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | CAKSBWQTZZGWDD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)NC2=NNC(=S)S2 |
Computed by PubChem (NCBI)