CAS 1152972-73-0 appears in our catalog under these names: 4-Hydroxy-1-(2,4,5-trichlorophenyl)-1H-pyrazole-3-carboxylic acid, 95%, 4-Hydroxy-1-(2,4,5-trichlorophenyl)-1H-pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid (CAS 1152972-73-0) is a chemical compound with the molecular formula C10H5Cl3N2O3 and a molecular weight of 307.5 g/mol. IUPAC name: 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid. InChIKey: HEHODTXZHOSVAM-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl3N2O3 |
|---|---|
| Molecular weight | 307.5 g/mol |
| IUPAC name | 4-hydroxy-1-(2,4,5-trichlorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | HEHODTXZHOSVAM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)N2C=C(C(=N2)C(=O)O)O |
Computed by PubChem (NCBI)