CAS 87376-16-7 is the registry number for Pyrrolomycin E. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,4-dichloro-6-(5-chloro-3-nitro-1H-pyrrol-2-yl)phenol (CAS 87376-16-7) is a chemical compound with the molecular formula C10H5Cl3N2O3 and a molecular weight of 307.5 g/mol. IUPAC name: 2,4-dichloro-6-(5-chloro-3-nitro-1H-pyrrol-2-yl)phenol. InChIKey: SGEOBHBCFXDBHD-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl3N2O3 |
|---|---|
| Molecular weight | 307.5 g/mol |
| IUPAC name | 2,4-dichloro-6-(5-chloro-3-nitro-1H-pyrrol-2-yl)phenol |
| InChIKey | SGEOBHBCFXDBHD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C2=C(C=C(N2)Cl)[N+](=O)[O-])O)Cl)Cl |
Computed by PubChem (NCBI)