CAS 1153039-63-4 is the registry number for 1-(2,4-Dimethylphenyl)-1H-pyrazol-4-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,4-dimethylphenyl)pyrazol-4-amine (CAS 1153039-63-4) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)pyrazol-4-amine. InChIKey: DOOQWPWSALVSLS-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)pyrazol-4-amine |
| InChIKey | DOOQWPWSALVSLS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C=C(C=N2)N)C |
Computed by PubChem (NCBI)