CAS 1153084-25-3 appears in our catalog under these names: 6-Bromo-8-chloro-1,4-dihydroquinolin-4-one, 98%, 6-Bromo-8-chloro-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 100mg.
6-bromo-8-chloro-1H-quinolin-4-one (CAS 1153084-25-3) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 6-bromo-8-chloro-1H-quinolin-4-one. InChIKey: JBPYCWMMCNFFGQ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 6-bromo-8-chloro-1H-quinolin-4-one |
| InChIKey | JBPYCWMMCNFFGQ-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C1=O)C=C(C=C2Cl)Br |
Computed by PubChem (NCBI)