Products 1153103-84-4
CAS 1153103-84-4 is the registry number for 3-fluoro-4-propan-2-yloxybenzonitrile, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-fluoro-4-propan-2-yloxybenzonitrile (CAS 1153103-84-4) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 3-fluoro-4-propan-2-yloxybenzonitrile. InChIKey: XVJJUVGWMZNQKZ-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 3-fluoro-4-propan-2-yloxybenzonitrile |
| InChIKey | XVJJUVGWMZNQKZ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C#N)F |
Computed by PubChem (NCBI)