CAS 1153198-78-7 is the registry number for 3-((2,4-Difluorobenzenesulfonyl)methyl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[(2,4-difluorophenyl)sulfonylmethyl]aniline (CAS 1153198-78-7) is a chemical compound with the molecular formula C13H11F2NO2S and a molecular weight of 283.30 g/mol. IUPAC name: 3-[(2,4-difluorophenyl)sulfonylmethyl]aniline. InChIKey: SQEBNLNLKCIDKO-UHFFFAOYSA-N.
| Molecular formula | C13H11F2NO2S |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | 3-[(2,4-difluorophenyl)sulfonylmethyl]aniline |
| InChIKey | SQEBNLNLKCIDKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)CS(=O)(=O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)