Products 1803581-34-1
CAS 1803581-34-1 appears in our catalog under these names: 2-(2-(2,5-Difluorophenyl)-1,3-thiazol-4-yl)-2-methylpropanoic acid, 95%, 2-(2-(2,5-Difluorophenyl)-1,3-thiazol-4-yl)-2-methylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoic acid (CAS 1803581-34-1) is a chemical compound with the molecular formula C13H11F2NO2S and a molecular weight of 283.30 g/mol. IUPAC name: 2-[2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoic acid. InChIKey: RJOVVWOESCKFGX-UHFFFAOYSA-N.
| Molecular formula | C13H11F2NO2S |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | 2-[2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoic acid |
| InChIKey | RJOVVWOESCKFGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CSC(=N1)C2=C(C=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)