CAS 1153327-12-8 appears in our catalog under these names: 4-Bromo-N,N-dimethylpyridine-2-carboxamide, 95%, 4-Bromo-N,N-dimethylpyridine-2-carboxamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
4-bromo-N,N-dimethylpyridine-2-carboxamide (CAS 1153327-12-8) is a chemical compound with the molecular formula C8H9BrN2O and a molecular weight of 229.07 g/mol. IUPAC name: 4-bromo-N,N-dimethylpyridine-2-carboxamide. InChIKey: NVDWELYHXZXMFZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 4-bromo-N,N-dimethylpyridine-2-carboxamide |
| InChIKey | NVDWELYHXZXMFZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=NC=CC(=C1)Br |
Computed by PubChem (NCBI)