CAS 115341-26-9 is the registry number for 1,3-Bis(4-maleimidophenoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[4-[3-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenoxy]phenyl]pyrrole-2,5-dione (CAS 115341-26-9) is a chemical compound with the molecular formula C26H16N2O6 and a molecular weight of 452.4 g/mol. IUPAC name: 1-[4-[3-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenoxy]phenyl]pyrrole-2,5-dione. InChIKey: UGJHILWNNSROJV-UHFFFAOYSA-N.
| Molecular formula | C26H16N2O6 |
|---|---|
| Molecular weight | 452.4 g/mol |
| IUPAC name | 1-[4-[3-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenoxy]phenyl]pyrrole-2,5-dione |
| InChIKey | UGJHILWNNSROJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)N3C(=O)C=CC3=O)OC4=CC=C(C=C4)N5C(=O)C=CC5=O |
Computed by PubChem (NCBI)