CAS 1428987-69-2 appears in our catalog under these names: Eltrombopag Impurity 38, 3,3′-(2-Amino-3-oxo-3H-phenoxazine-4,6-diyl)bis(benzoic acid). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
3-[8-amino-6-(3-carboxyphenyl)-7-oxophenoxazin-4-yl]benzoic acid (CAS 1428987-69-2) is a chemical compound with the molecular formula C26H16N2O6 and a molecular weight of 452.4 g/mol. IUPAC name: 3-[8-amino-6-(3-carboxyphenyl)-7-oxophenoxazin-4-yl]benzoic acid. InChIKey: QRTNLSVMCSHKCG-UHFFFAOYSA-N.
| Molecular formula | C26H16N2O6 |
|---|---|
| Molecular weight | 452.4 g/mol |
| IUPAC name | 3-[8-amino-6-(3-carboxyphenyl)-7-oxophenoxazin-4-yl]benzoic acid |
| InChIKey | QRTNLSVMCSHKCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=C3C(=CC=C2)N=C4C=C(C(=O)C(=C4O3)C5=CC(=CC=C5)C(=O)O)N |
Computed by PubChem (NCBI)