Products 1153558-30-5
CAS 1153558-30-5 is the registry number for N,N-Diallyl-5-bromothiophene-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N,N-bis(prop-2-enyl)thiophene-3-carboxamide (CAS 1153558-30-5) is a chemical compound with the molecular formula C11H12BrNOS and a molecular weight of 286.19 g/mol. IUPAC name: 5-bromo-N,N-bis(prop-2-enyl)thiophene-3-carboxamide. InChIKey: DPNGULDFYKPOQF-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNOS |
|---|---|
| Molecular weight | 286.19 g/mol |
| IUPAC name | 5-bromo-N,N-bis(prop-2-enyl)thiophene-3-carboxamide |
| InChIKey | DPNGULDFYKPOQF-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)C(=O)C1=CSC(=C1)Br |
Computed by PubChem (NCBI)