CAS 2789682-45-5 is the registry number for 2'-Bromo-3',5'-dimethyl-5',6'-dihydro-4'H-spiro[cyclopropane-1,7'-thieno[3,2-c]pyridin]-4'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3,5-dimethylspiro[6H-thieno[3,2-c]pyridine-7,1'-cyclopropane]-4-one (CAS 2789682-45-5) is a chemical compound with the molecular formula C11H12BrNOS and a molecular weight of 286.19 g/mol. IUPAC name: 2-bromo-3,5-dimethylspiro[6H-thieno[3,2-c]pyridine-7,1'-cyclopropane]-4-one. InChIKey: UOZDBIXIOCLUPR-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNOS |
|---|---|
| Molecular weight | 286.19 g/mol |
| IUPAC name | 2-bromo-3,5-dimethylspiro[6H-thieno[3,2-c]pyridine-7,1'-cyclopropane]-4-one |
| InChIKey | UOZDBIXIOCLUPR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)N(CC23CC3)C)Br |
Computed by PubChem (NCBI)