CAS 1153631-91-4 is the registry number for CLT-28643. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-methoxyanilino)-6-(methylcarbamoyl)quinoline-3-carboxylic acid (CAS 1153631-91-4) is a chemical compound with the molecular formula C19H17N3O4 and a molecular weight of 351.4 g/mol. IUPAC name: 4-(4-methoxyanilino)-6-(methylcarbamoyl)quinoline-3-carboxylic acid. InChIKey: TYORCOLIIIUMSE-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 4-(4-methoxyanilino)-6-(methylcarbamoyl)quinoline-3-carboxylic acid |
| InChIKey | TYORCOLIIIUMSE-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC2=C(C(=CN=C2C=C1)C(=O)O)NC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)