CAS 30958-38-4 is the registry number for 4-METHYL-5-NITRO-2,6-BIS(PHENYLMETHOXY)PYRIMIDINE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-5-nitro-2,6-bis(phenylmethoxy)pyrimidine (CAS 30958-38-4) is a chemical compound with the molecular formula C19H17N3O4 and a molecular weight of 351.4 g/mol. IUPAC name: 4-methyl-5-nitro-2,6-bis(phenylmethoxy)pyrimidine. InChIKey: ZYYQKUHBUQEQRA-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 4-methyl-5-nitro-2,6-bis(phenylmethoxy)pyrimidine |
| InChIKey | ZYYQKUHBUQEQRA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)OCC2=CC=CC=C2)OCC3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)