Products 1153761-13-7
CAS 1153761-13-7 is the registry number for (5-(4-Bromophenyl)-1,3,4-oxadiazol-2-yl)methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methanol (CAS 1153761-13-7) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methanol. InChIKey: XMOUFJKDAQKZEH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]methanol |
| InChIKey | XMOUFJKDAQKZEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)CO)Br |
Computed by PubChem (NCBI)