Products 1154284-20-4
CAS 1154284-20-4 is the registry number for 1-(3,4-Dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-yloxy)ethan-1-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(3,4-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-yloxy)ethanone (CAS 1154284-20-4) is a chemical compound with the molecular formula C17H14Cl2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-yloxy)ethanone. InChIKey: YXQHIURUWPIYFD-UHFFFAOYSA-N.
| Molecular formula | C17H14Cl2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-yloxy)ethanone |
| InChIKey | YXQHIURUWPIYFD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)OCC(=O)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)