Products 35333-17-6
CAS 35333-17-6 is the registry number for 1,5-Bis(4-chlorophenyl)pentane-1,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,5-bis(4-chlorophenyl)pentane-1,5-dione (CAS 35333-17-6) is a chemical compound with the molecular formula C17H14Cl2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 1,5-bis(4-chlorophenyl)pentane-1,5-dione. InChIKey: OEBPMFZFNICNFE-UHFFFAOYSA-N.
| Molecular formula | C17H14Cl2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 1,5-bis(4-chlorophenyl)pentane-1,5-dione |
| InChIKey | OEBPMFZFNICNFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCCC(=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)