Products 1154382-72-5
CAS 1154382-72-5 appears in our catalog under these names: (6-Chloropyridin-3-yl)(1,1-dioxidothiomorpholino)methanone, 98%, (6-​Chloro-​3-​pyridinyl)​(1,​1-​dioxido-​4-​thiomorpholinyl)​-methanone. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(6-chloro-3-pyridinyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (CAS 1154382-72-5) is a chemical compound with the molecular formula C10H11ClN2O3S and a molecular weight of 274.72 g/mol. IUPAC name: (6-chloro-3-pyridinyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone. InChIKey: RYZWRHQMWPDZBT-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O3S |
|---|---|
| Molecular weight | 274.72 g/mol |
| IUPAC name | (6-chloro-3-pyridinyl)-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| InChIKey | RYZWRHQMWPDZBT-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)