CAS 929973-97-7 is the registry number for 1-(Chloroacetyl)indoline-5-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(2-chloroacetyl)-2,3-dihydroindole-5-sulfonamide (CAS 929973-97-7) is a chemical compound with the molecular formula C10H11ClN2O3S and a molecular weight of 274.72 g/mol. IUPAC name: 1-(2-chloroacetyl)-2,3-dihydroindole-5-sulfonamide. InChIKey: IIUNBAYUUAETNG-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O3S |
|---|---|
| Molecular weight | 274.72 g/mol |
| IUPAC name | 1-(2-chloroacetyl)-2,3-dihydroindole-5-sulfonamide |
| InChIKey | IIUNBAYUUAETNG-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=C(C=C2)S(=O)(=O)N)C(=O)CCl |
Computed by PubChem (NCBI)