Products 1154571-03-5
CAS 1154571-03-5 is the registry number for 2-(3-Aminophenyl)-2-azaspiro(4.4)nonane-1,3-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-aminophenyl)-2-azaspiro[4.4]nonane-1,3-dione (CAS 1154571-03-5) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: 2-(3-aminophenyl)-2-azaspiro[4.4]nonane-1,3-dione. InChIKey: KTFPWRGUBKCAEK-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 2-(3-aminophenyl)-2-azaspiro[4.4]nonane-1,3-dione |
| InChIKey | KTFPWRGUBKCAEK-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CC(=O)N(C2=O)C3=CC=CC(=C3)N |
Computed by PubChem (NCBI)