CAS 1154704-31-0 is the registry number for 4-[5-(2-Chlorophenyl)-1,2,4-oxadiazol-3-yl]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]aniline (CAS 1154704-31-0) is a chemical compound with the molecular formula C14H10ClN3O and a molecular weight of 271.70 g/mol. IUPAC name: 4-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]aniline. InChIKey: NLNQGBJFOKQUTC-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3O |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 4-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]aniline |
| InChIKey | NLNQGBJFOKQUTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NO2)C3=CC=C(C=C3)N)Cl |
Computed by PubChem (NCBI)