CAS 430459-69-1 is the registry number for 5-(2-Chloro-4-methylphenyl)-3-(pyridin-2-yl)-1,2,4-oxadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-chloro-4-methylphenyl)-3-pyridin-2-yl-1,2,4-oxadiazole (CAS 430459-69-1) is a chemical compound with the molecular formula C14H10ClN3O and a molecular weight of 271.70 g/mol. IUPAC name: 5-(2-chloro-4-methylphenyl)-3-pyridin-2-yl-1,2,4-oxadiazole. InChIKey: DJTPZUYTPVBPKW-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3O |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 5-(2-chloro-4-methylphenyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
| InChIKey | DJTPZUYTPVBPKW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=NC(=NO2)C3=CC=CC=N3)Cl |
Computed by PubChem (NCBI)