Products 115476-23-8

CAS 115476-23-8 is the registry number for 2-Amino-3,3,3-trifluoro-2-methylpropanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-amino-3,3,3-trifluoro-2-methylpropanoic acid;hydrochloride (CAS 115476-23-8) is a chemical compound with the molecular formula C4H7ClF3NO2 and a molecular weight of 193.55 g/mol. IUPAC name: 2-amino-3,3,3-trifluoro-2-methylpropanoic acid;hydrochloride. InChIKey: OAWUZNVJBGNGEH-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7ClF3NO2
Molecular weight193.55 g/mol
IUPAC name2-amino-3,3,3-trifluoro-2-methylpropanoic acid;hydrochloride
InChIKeyOAWUZNVJBGNGEH-UHFFFAOYSA-N
SMILESCC(C(=O)O)(C(F)(F)F)N.Cl

Computed by PubChem (NCBI)