Products 91291-66-6

CAS 91291-66-6 is the registry number for 3-Amino-4,4,4-trifluorobutyric acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-amino-4,4,4-trifluorobutanoic acid;hydrochloride (CAS 91291-66-6) is a chemical compound with the molecular formula C4H7ClF3NO2 and a molecular weight of 193.55 g/mol. IUPAC name: 3-amino-4,4,4-trifluorobutanoic acid;hydrochloride. InChIKey: MRMARVCQZOYQPI-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7ClF3NO2
Molecular weight193.55 g/mol
IUPAC name3-amino-4,4,4-trifluorobutanoic acid;hydrochloride
InChIKeyMRMARVCQZOYQPI-UHFFFAOYSA-N
SMILESC(C(C(F)(F)F)N)C(=O)O.Cl

Computed by PubChem (NCBI)