Products 1154868-75-3

CAS 1154868-75-3 is the registry number for 1-Cyclopentyl-2-piperazinone trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-cyclopentylpiperazin-2-one;2,2,2-trifluoroacetic acid (CAS 1154868-75-3) is a chemical compound with the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. IUPAC name: 1-cyclopentylpiperazin-2-one;2,2,2-trifluoroacetic acid. InChIKey: DVSXPKITUZJOJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17F3N2O3
Molecular weight282.26 g/mol
IUPAC name1-cyclopentylpiperazin-2-one;2,2,2-trifluoroacetic acid
InChIKeyDVSXPKITUZJOJJ-UHFFFAOYSA-N
SMILESC1CCC(C1)N2CCNCC2=O.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)