CAS 2138080-67-6 is the registry number for 1-{2,7-Diazaspiro(3.5)nonan-7-yl}ethan-1-one, trifluoroacetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,7-diazaspiro[3.5]nonan-7-yl)ethanone;2,2,2-trifluoroacetic acid (CAS 2138080-67-6) is a chemical compound with the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. IUPAC name: 1-(2,7-diazaspiro[3.5]nonan-7-yl)ethanone;2,2,2-trifluoroacetic acid. InChIKey: JUEZZBKHZKYQIX-UHFFFAOYSA-N.
| Molecular formula | C11H17F3N2O3 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | 1-(2,7-diazaspiro[3.5]nonan-7-yl)ethanone;2,2,2-trifluoroacetic acid |
| InChIKey | JUEZZBKHZKYQIX-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2(CC1)CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)