CAS 1154870-60-6 is the registry number for tert-Butyl N-[(1S,3R)-rel-3-fluorocyclopentyl]carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(1S,3R)-3-fluorocyclopentyl]carbamate (CAS 1154870-60-6) is a chemical compound with the molecular formula C10H18FNO2 and a molecular weight of 203.25 g/mol. IUPAC name: tert-butyl N-[(1S,3R)-3-fluorocyclopentyl]carbamate. InChIKey: BBJACCZSJXCXSE-SFYZADRCSA-N.
| Molecular formula | C10H18FNO2 |
|---|---|
| Molecular weight | 203.25 g/mol |
| IUPAC name | tert-butyl N-[(1S,3R)-3-fluorocyclopentyl]carbamate |
| InChIKey | BBJACCZSJXCXSE-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](C1)F |
Computed by PubChem (NCBI)