CAS 2581763-00-8 is the registry number for Rel-tert-butyl ((1R,2R)-2-(fluoromethyl)cyclobutyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R,2R)-2-(fluoromethyl)cyclobutyl]carbamate (CAS 2581763-00-8) is a chemical compound with the molecular formula C10H18FNO2 and a molecular weight of 203.25 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-(fluoromethyl)cyclobutyl]carbamate. InChIKey: IHHSXCLECNNDPN-JGVFFNPUSA-N.
| Molecular formula | C10H18FNO2 |
|---|---|
| Molecular weight | 203.25 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-(fluoromethyl)cyclobutyl]carbamate |
| InChIKey | IHHSXCLECNNDPN-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H]1CF |
Computed by PubChem (NCBI)