CAS 1154949-80-0 is the registry number for Mirabegron Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(4-nitrophenyl)ethyl]-2-phenylethanamine (CAS 1154949-80-0) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: N-[2-(4-nitrophenyl)ethyl]-2-phenylethanamine. InChIKey: FVUCJWNYDYBQSF-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | N-[2-(4-nitrophenyl)ethyl]-2-phenylethanamine |
| InChIKey | FVUCJWNYDYBQSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNCCC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)