CAS 1154973-77-9 is the registry number for 3-(1,1-Dioxidothiomorpholino)-2-methylpropanimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropanimidamide (CAS 1154973-77-9) is a chemical compound with the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. IUPAC name: 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropanimidamide. InChIKey: MDVBYDJKDRPSJM-UHFFFAOYSA-N.
| Molecular formula | C8H17N3O2S |
|---|---|
| Molecular weight | 219.31 g/mol |
| IUPAC name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropanimidamide |
| InChIKey | MDVBYDJKDRPSJM-UHFFFAOYSA-N |
| SMILES | CC(CN1CCS(=O)(=O)CC1)C(=N)N |
Computed by PubChem (NCBI)