CAS 1248248-38-5 is the registry number for N′-(2-cyanopropyl)-n-methyl-n-(1-methylethyl)sulfamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-cyano-1-[[methyl(propan-2-yl)sulfamoyl]amino]propane (CAS 1248248-38-5) is a chemical compound with the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. IUPAC name: 2-cyano-1-[[methyl(propan-2-yl)sulfamoyl]amino]propane. InChIKey: HEAMHJRLQCEWFG-UHFFFAOYSA-N.
| Molecular formula | C8H17N3O2S |
|---|---|
| Molecular weight | 219.31 g/mol |
| IUPAC name | 2-cyano-1-[[methyl(propan-2-yl)sulfamoyl]amino]propane |
| InChIKey | HEAMHJRLQCEWFG-UHFFFAOYSA-N |
| SMILES | CC(C)N(C)S(=O)(=O)NCC(C)C#N |
Computed by PubChem (NCBI)